C13H18ClN2+ — CID 134869549
[(E)-3-[(5Z)-5-[chloro(dimethylamino)methylidene]cyclopenta-1,3-dien-1-yl]prop-2-enylidene]-dimethylazanium (PubChem CID 134869549) has the molecular formula C13H18ClN2+ and a molecular weight of 237.75 g/mol. Its IUPAC name is [(E)-3-[(5Z)-5-[chloro(dimethylamino)methylidene]cyclopenta-1,3-dien-1-yl]prop-2-enylidene]-dimethylazanium.
| Compound Name | [(E)-3-[(5Z)-5-[chloro(dimethylamino)methylidene]cyclopenta-1,3-dien-1-yl]prop-2-enylidene]-dimethylazanium |
|---|---|
| PubChem CID | 134869549 |
| Molecular Formula | C13H18ClN2+ |
| Molecular Weight | 237.75 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | [(E)-3-[(5Z)-5-[chloro(dimethylamino)methylidene]cyclopenta-1,3-dien-1-yl]prop-2-enylidene]-dimethylazanium |
| SMILES | CN(C)/C(Cl)=C1\C=CC=C1/C=C/C=[N+](C)C |
| InChI | InChI=1S/C13H18ClN2/c1-15(2)10-6-8-11-7-5-9-12(11)13(14)16(3)4/h5-10H,1-4H3/q+1 |
| InChIKey | OVEJADDHEYYGOX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.75 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|