C14H22ClN — CID 145143725
(Z)-N-[(1E,3E)-2-[(Z)-but-1-enyl]-1-chloro-3-methylhepta-1,3-dienyl]ethanimine (PubChem CID 145143725) has the molecular formula C14H22ClN and a molecular weight of 239.79 g/mol. Its IUPAC name is (Z)-N-[(1E,3E)-2-[(Z)-but-1-enyl]-1-chloro-3-methylhepta-1,3-dienyl]ethanimine.
| Compound Name | (Z)-N-[(1E,3E)-2-[(Z)-but-1-enyl]-1-chloro-3-methylhepta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 145143725 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | (Z)-N-[(1E,3E)-2-[(Z)-but-1-enyl]-1-chloro-3-methylhepta-1,3-dienyl]ethanimine |
| SMILES | C/C=N\C(Cl)=C(\C=C/CC)C(/C)=C/CCC |
| InChI | InChI=1S/C14H22ClN/c1-5-8-10-12(4)13(11-9-6-2)14(15)16-7-3/h7,9-11H,5-6,8H2,1-4H3/b11-9-,12-10+,14-13-,16-7- |
| InChIKey | BQKJPENBRXAJLM-ASAXOOPKSA-N |
| XLogP | 5.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|