C11H19N — CID 91281205
N-(2-ethylhepta-1,3-dienyl)ethanimine (PubChem CID 91281205) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is N-(2-ethylhepta-1,3-dienyl)ethanimine.
| Compound Name | N-(2-ethylhepta-1,3-dienyl)ethanimine |
|---|---|
| PubChem CID | 91281205 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-(2-ethylhepta-1,3-dienyl)ethanimine |
| SMILES | C/C=N/C=C(C=CCCC)CC |
| InChI | InChI=1S/C11H19N/c1-4-7-8-9-11(5-2)10-12-6-3/h6,8-10H,4-5,7H2,1-3H3/b9-8?,11-10?,12-6+ |
| InChIKey | XMYSPYMIWKALNS-DHCVTCHKSA-N |
| XLogP | 3.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|