C18H26N2O2 — CID 134870168
5-benzyl-3,6-diethoxy-5-propan-2-yl-2H-pyrazine (PubChem CID 134870168) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 5-benzyl-3,6-diethoxy-5-propan-2-yl-2H-pyrazine.
| Compound Name | 5-benzyl-3,6-diethoxy-5-propan-2-yl-2H-pyrazine |
|---|---|
| PubChem CID | 134870168 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 5-benzyl-3,6-diethoxy-5-propan-2-yl-2H-pyrazine |
| SMILES | CCOC1=NC(Cc2ccccc2)(C(C)C)C(OCC)=NC1 |
| InChI | InChI=1S/C18H26N2O2/c1-5-21-16-13-19-17(22-6-2)18(20-16,14(3)4)12-15-10-8-7-9-11-15/h7-11,14H,5-6,12-13H2,1-4H3 |
| InChIKey | INORAEVOEFCJRU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |