C10H4BrF17Mg — CID 134870375
magnesium;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane;bromide (PubChem CID 134870375) has the molecular formula C10H4BrF17Mg and a molecular weight of 551.32 g/mol. Its IUPAC name is magnesium;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane;bromide.
| Compound Name | magnesium;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane;bromide |
|---|---|
| PubChem CID | 134870375 |
| Molecular Formula | C10H4BrF17Mg |
| Molecular Weight | 551.32 g/mol |
| Exact Mass | 549.91 |
| IUPAC Name | magnesium;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane;bromide |
| SMILES | [Br-].[CH2-]CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Mg+2] |
| InChI | InChI=1S/C10H4F17.BrH.Mg/c1-2-3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27;;/h1-2H2;1H;/q-1;;+2/p-1 |
| InChIKey | QOVQDKHMARREJY-UHFFFAOYSA-M |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|