C29H53NO6Si2 — CID 134870749
benzyl N-[(2S,3S,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5-dihydroxyoct-7-en-4-yl]carbamate (PubChem CID 134870749) has the molecular formula C29H53NO6Si2 and a molecular weight of 567.92 g/mol. Its IUPAC name is benzyl N-[(2S,3S,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5-dihydroxyoct-7-en-4-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5-dihydroxyoct-7-en-4-yl]carbamate |
|---|---|
| PubChem CID | 134870749 |
| Molecular Formula | C29H53NO6Si2 |
| Molecular Weight | 567.92 g/mol |
| Exact Mass | 567.34 |
| IUPAC Name | benzyl N-[(2S,3S,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5-dihydroxyoct-7-en-4-yl]carbamate |
| SMILES | C=CC[C@@H](O)[C@H](NC(=O)OCc1ccccc1)[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H53NO6Si2/c1-12-16-24(31)26(30-27(33)34-19-22-17-14-13-15-18-22)23(20-35-37(8,9)28(2,3)4)25(32)21-36-38(10,11)29(5,6)7/h12-15,17-18,23-26,31-32H,1,16,19-21H2,2-11H3,(H,30,33)/t23-,24+,25+,26+/m0/s1 |
| InChIKey | UCPXRNXGGDUREU-BKKFENPESA-N |
| XLogP | 6.24 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.92 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|