C10H9ClN4O — CID 134871170
(E)-4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-6-isocyanatocyclohexa-2,4-dien-1-imine (PubChem CID 134871170) has the molecular formula C10H9ClN4O and a molecular weight of 236.66 g/mol. Its IUPAC name is (E)-4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-6-isocyanatocyclohexa-2,4-dien-1-imine.
| Compound Name | (E)-4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-6-isocyanatocyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 134871170 |
| Molecular Formula | C10H9ClN4O |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | (E)-4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-6-isocyanatocyclohexa-2,4-dien-1-imine |
| SMILES | O=C=NC1C=C(Cl)C=C/C1=N\C1=NCCN1 |
| InChI | InChI=1S/C10H9ClN4O/c11-7-1-2-8(9(5-7)14-6-16)15-10-12-3-4-13-10/h1-2,5,9H,3-4H2,(H,12,13)/b15-8+ |
| InChIKey | BPZBQQOKHLSXEP-OVCLIPMQSA-N |
| XLogP | 0.78 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|