C19H25NO2 — CID 134872646
[(Z)-[3-methyl-3-(2-methylpropyl)-2-prop-2-enylcyclobutylidene]amino] benzoate (PubChem CID 134872646) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is [(Z)-[3-methyl-3-(2-methylpropyl)-2-prop-2-enylcyclobutylidene]amino] benzoate.
| Compound Name | [(Z)-[3-methyl-3-(2-methylpropyl)-2-prop-2-enylcyclobutylidene]amino] benzoate |
|---|---|
| PubChem CID | 134872646 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | [(Z)-[3-methyl-3-(2-methylpropyl)-2-prop-2-enylcyclobutylidene]amino] benzoate |
| SMILES | C=CCC1/C(=N\OC(=O)c2ccccc2)CC1(C)CC(C)C |
| InChI | InChI=1S/C19H25NO2/c1-5-9-16-17(13-19(16,4)12-14(2)3)20-22-18(21)15-10-7-6-8-11-15/h5-8,10-11,14,16H,1,9,12-13H2,2-4H3/b20-17- |
| InChIKey | UFSKIURKVULEJI-JZJYNLBNSA-N |
| XLogP | 4.85 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|