C16H22O5S — CID 134872687
methyl 3-(benzenesulfonyl)-3-(1-hydroxycyclohexyl)propanoate (PubChem CID 134872687) has the molecular formula C16H22O5S and a molecular weight of 326.41 g/mol. Its IUPAC name is methyl 3-(benzenesulfonyl)-3-(1-hydroxycyclohexyl)propanoate.
| Compound Name | methyl 3-(benzenesulfonyl)-3-(1-hydroxycyclohexyl)propanoate |
|---|---|
| PubChem CID | 134872687 |
| Molecular Formula | C16H22O5S |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | methyl 3-(benzenesulfonyl)-3-(1-hydroxycyclohexyl)propanoate |
| SMILES | COC(=O)CC(C1(O)CCCCC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O5S/c1-21-15(17)12-14(16(18)10-6-3-7-11-16)22(19,20)13-8-4-2-5-9-13/h2,4-5,8-9,14,18H,3,6-7,10-12H2,1H3 |
| InChIKey | KKBUWGKSTOGJGA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |