C26H23F3O8S — CID 134872919
dibenzyl (2S,3R)-2-phenylmethoxy-3-(trifluoromethylsulfonyloxy)butanedioate (PubChem CID 134872919) has the molecular formula C26H23F3O8S and a molecular weight of 552.52 g/mol. Its IUPAC name is dibenzyl (2S,3R)-2-phenylmethoxy-3-(trifluoromethylsulfonyloxy)butanedioate.
| Compound Name | dibenzyl (2S,3R)-2-phenylmethoxy-3-(trifluoromethylsulfonyloxy)butanedioate |
|---|---|
| PubChem CID | 134872919 |
| Molecular Formula | C26H23F3O8S |
| Molecular Weight | 552.52 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | dibenzyl (2S,3R)-2-phenylmethoxy-3-(trifluoromethylsulfonyloxy)butanedioate |
| SMILES | O=C(OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](OS(=O)(=O)C(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H23F3O8S/c27-26(28,29)38(32,33)37-23(25(31)36-18-21-14-8-3-9-15-21)22(34-16-19-10-4-1-5-11-19)24(30)35-17-20-12-6-2-7-13-20/h1-15,22-23H,16-18H2/t22-,23+/m0/s1 |
| InChIKey | GCGXZQYDKIFFKL-XZOQPEGZSA-N |
| XLogP | 4.29 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|