C16H16O2 — CID 134873149
2-butyl-3-(2-ethenylphenyl)buta-1,3-diene-1,4-dione (PubChem CID 134873149) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-butyl-3-(2-ethenylphenyl)buta-1,3-diene-1,4-dione.
| Compound Name | 2-butyl-3-(2-ethenylphenyl)buta-1,3-diene-1,4-dione |
|---|---|
| PubChem CID | 134873149 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-butyl-3-(2-ethenylphenyl)buta-1,3-diene-1,4-dione |
| SMILES | C=Cc1ccccc1C(=C=O)C(=C=O)CCCC |
| InChI | InChI=1S/C16H16O2/c1-3-5-8-14(11-17)16(12-18)15-10-7-6-9-13(15)4-2/h4,6-7,9-10H,2-3,5,8H2,1H3 |
| InChIKey | GKASEOGQGFFSFX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|