About carbon monoxide;chromium;2-cyclopropyl-2-[(3-methoxyphenyl)methoxy]ethenone
carbon monoxide;chromium;2-cyclopropyl-2-[(3-methoxyphenyl)methoxy]ethenone (PubChem CID 134874110) has the molecular formula C17H14CrO7
and a molecular weight of 382.29 g/mol. Its IUPAC name is carbon monoxide;chromium;2-cyclopropyl-2-[(3-methoxyphenyl)methoxy]ethenone.
Molecular Properties
| Compound Name | carbon monoxide;chromium;2-cyclopropyl-2-[(3-methoxyphenyl)methoxy]ethenone |
| PubChem CID | 134874110 |
| Molecular Formula | C17H14CrO7 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | carbon monoxide;chromium;2-cyclopropyl-2-[(3-methoxyphenyl)methoxy]ethenone |
| SMILES | COc1cccc(COC(=C=O)C2CC2)c1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C13H14O3.4CO.Cr/c1-15-12-4-2-3-10(7-12)9-16-13(8-14)11-5-6-11;4*1-2;/h2-4,7,11H,5-6,9H2,1H3;;;;; |
| InChIKey | FSYSOXPVVCJGKZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 115.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;chromium;2-cyclopropyl-2-[(3-methoxyphenyl)methoxy]ethenone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;chromium;2-cyclopropyl-2-[(3-methoxyphenyl)methoxy]ethenone?
The IUPAC name of carbon monoxide;chromium;2-cyclopropyl-2-[(3-methoxyphenyl)methoxy]ethenone (CID 134874110) is carbon monoxide;chromium;2-cyclopropyl-2-[(3-methoxyphenyl)methoxy]ethenone.
What is the SMILES notation for carbon monoxide;chromium;2-cyclopropyl-2-[(3-methoxyphenyl)methoxy]ethenone?
The canonical SMILES for carbon monoxide;chromium;2-cyclopropyl-2-[(3-methoxyphenyl)methoxy]ethenone is COc1cccc(COC(=C=O)C2CC2)c1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].
What is the InChIKey of carbon monoxide;chromium;2-cyclopropyl-2-[(3-methoxyphenyl)methoxy]ethenone?
The InChIKey is FSYSOXPVVCJGKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O3.4CO.Cr/c1-15-12-4-2-3-10(7-12)9-16-13(8-14)11-5-6-11;4*1-2;/h2-4,7,11H,5-6,9H2,1H3;;;;;.
What are the key properties of carbon monoxide;chromium;2-cyclopropyl-2-[(3-methoxyphenyl)methoxy]ethenone?
carbon monoxide;chromium;2-cyclopropyl-2-[(3-methoxyphenyl)methoxy]ethenone has a molecular weight of 382.29 g/mol, XLogP of 2.18, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;chromium;2-cyclopropyl-2-[(3-methoxyphenyl)methoxy]ethenone is sourced from PubChem (CID 134874110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).