C21H29NO3 — CID 134874914
benzyl N-[(2R)-5-(5-butylfuran-2-yl)pentan-2-yl]carbamate (PubChem CID 134874914) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is benzyl N-[(2R)-5-(5-butylfuran-2-yl)pentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-5-(5-butylfuran-2-yl)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 134874914 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | benzyl N-[(2R)-5-(5-butylfuran-2-yl)pentan-2-yl]carbamate |
| SMILES | CCCCc1ccc(CCC[C@@H](C)NC(=O)OCc2ccccc2)o1 |
| InChI | InChI=1S/C21H29NO3/c1-3-4-12-19-14-15-20(25-19)13-8-9-17(2)22-21(23)24-16-18-10-6-5-7-11-18/h5-7,10-11,14-15,17H,3-4,8-9,12-13,16H2,1-2H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | OLQJOWKMNKZNQZ-QGZVFWFLSA-N |
| XLogP | 5.26 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |