C22H33NO3 — CID 11760161
benzyl N-[(2S)-6-methylidene-9-oxotridecan-2-yl]carbamate (PubChem CID 11760161) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is benzyl N-[(2S)-6-methylidene-9-oxotridecan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-6-methylidene-9-oxotridecan-2-yl]carbamate |
|---|---|
| PubChem CID | 11760161 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | benzyl N-[(2S)-6-methylidene-9-oxotridecan-2-yl]carbamate |
| SMILES | C=C(CCC[C@H](C)NC(=O)OCc1ccccc1)CCC(=O)CCCC |
| InChI | InChI=1S/C22H33NO3/c1-4-5-14-21(24)16-15-18(2)10-9-11-19(3)23-22(25)26-17-20-12-7-6-8-13-20/h6-8,12-13,19H,2,4-5,9-11,14-17H2,1,3H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | UVJOBAMQDVEFAF-IBGZPJMESA-N |
| XLogP | 5.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|