C30H51NO10 — CID 158392584
benzyl N-[(2R)-9-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-8-oxononan-2-yl]carbamate (PubChem CID 158392584) has the molecular formula C30H51NO10 and a molecular weight of 585.74 g/mol. Its IUPAC name is benzyl N-[(2R)-9-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-8-oxononan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-9-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-8-oxononan-2-yl]carbamate |
|---|---|
| PubChem CID | 158392584 |
| Molecular Formula | C30H51NO10 |
| Molecular Weight | 585.74 g/mol |
| Exact Mass | 585.35 |
| IUPAC Name | benzyl N-[(2R)-9-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-8-oxononan-2-yl]carbamate |
| SMILES | COCCOCCOCCOCCOCCOCCOCC(=O)CCCCC[C@@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H51NO10/c1-27(31-30(33)41-25-28-10-6-4-7-11-28)9-5-3-8-12-29(32)26-40-24-23-39-22-21-38-20-19-37-18-17-36-16-15-35-14-13-34-2/h4,6-7,10-11,27H,3,5,8-9,12-26H2,1-2H3,(H,31,33)/t27-/m1/s1 |
| InChIKey | GXDLMHIKBVAFAF-HHHXNRCGSA-N |
| XLogP | 3.57 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.74 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|