C34H40N4O2S — CID 134875931
7,8-bis(diethylamino)-1-ethylsulfanyl-2,4,6-triphenyl-2,6-diazabicyclo[2.2.2]oct-7-ene-3,5-dione (PubChem CID 134875931) has the molecular formula C34H40N4O2S and a molecular weight of 568.79 g/mol. Its IUPAC name is 7,8-bis(diethylamino)-1-ethylsulfanyl-2,4,6-triphenyl-2,6-diazabicyclo[2.2.2]oct-7-ene-3,5-dione.
| Compound Name | 7,8-bis(diethylamino)-1-ethylsulfanyl-2,4,6-triphenyl-2,6-diazabicyclo[2.2.2]oct-7-ene-3,5-dione |
|---|---|
| PubChem CID | 134875931 |
| Molecular Formula | C34H40N4O2S |
| Molecular Weight | 568.79 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 7,8-bis(diethylamino)-1-ethylsulfanyl-2,4,6-triphenyl-2,6-diazabicyclo[2.2.2]oct-7-ene-3,5-dione |
| SMILES | CCSC12C(N(CC)CC)=C(N(CC)CC)C(c3ccccc3)(C(=O)N1c1ccccc1)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C34H40N4O2S/c1-6-35(7-2)29-30(36(8-3)9-4)34(41-10-5)37(27-22-16-12-17-23-27)31(39)33(29,26-20-14-11-15-21-26)32(40)38(34)28-24-18-13-19-25-28/h11-25H,6-10H2,1-5H3 |
| InChIKey | OCMXJYPVDJOGDU-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.79 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|