C35H42N4O2S — CID 134875932
4-benzyl-7,8-bis(diethylamino)-1-ethylsulfanyl-2,6-diphenyl-2,6-diazabicyclo[2.2.2]oct-7-ene-3,5-dione (PubChem CID 134875932) has the molecular formula C35H42N4O2S and a molecular weight of 582.81 g/mol. Its IUPAC name is 4-benzyl-7,8-bis(diethylamino)-1-ethylsulfanyl-2,6-diphenyl-2,6-diazabicyclo[2.2.2]oct-7-ene-3,5-dione.
| Compound Name | 4-benzyl-7,8-bis(diethylamino)-1-ethylsulfanyl-2,6-diphenyl-2,6-diazabicyclo[2.2.2]oct-7-ene-3,5-dione |
|---|---|
| PubChem CID | 134875932 |
| Molecular Formula | C35H42N4O2S |
| Molecular Weight | 582.81 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | 4-benzyl-7,8-bis(diethylamino)-1-ethylsulfanyl-2,6-diphenyl-2,6-diazabicyclo[2.2.2]oct-7-ene-3,5-dione |
| SMILES | CCSC12C(N(CC)CC)=C(N(CC)CC)C(Cc3ccccc3)(C(=O)N1c1ccccc1)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C35H42N4O2S/c1-6-36(7-2)30-31(37(8-3)9-4)35(42-10-5)38(28-22-16-12-17-23-28)32(40)34(30,26-27-20-14-11-15-21-27)33(41)39(35)29-24-18-13-19-25-29/h11-25H,6-10,26H2,1-5H3 |
| InChIKey | NKBHJXDEHISODU-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.81 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|