C18H16N2O2S — CID 134873866
1-(dimethylamino)-4,6-diphenyl-2-thia-6-azabicyclo[2.2.0]hexane-3,5-dione (PubChem CID 134873866) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-(dimethylamino)-4,6-diphenyl-2-thia-6-azabicyclo[2.2.0]hexane-3,5-dione.
| Compound Name | 1-(dimethylamino)-4,6-diphenyl-2-thia-6-azabicyclo[2.2.0]hexane-3,5-dione |
|---|---|
| PubChem CID | 134873866 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 1-(dimethylamino)-4,6-diphenyl-2-thia-6-azabicyclo[2.2.0]hexane-3,5-dione |
| SMILES | CN(C)C12SC(=O)C1(c1ccccc1)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C18H16N2O2S/c1-19(2)18-17(16(22)23-18,13-9-5-3-6-10-13)15(21)20(18)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | JQXAQTNIRRKYLL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|