C23H18N2O2S — CID 134873628
1-(N-methylanilino)-4,6-diphenyl-2-thia-6-azabicyclo[2.2.0]hexane-3,5-dione (PubChem CID 134873628) has the molecular formula C23H18N2O2S and a molecular weight of 386.48 g/mol. Its IUPAC name is 1-(N-methylanilino)-4,6-diphenyl-2-thia-6-azabicyclo[2.2.0]hexane-3,5-dione.
| Compound Name | 1-(N-methylanilino)-4,6-diphenyl-2-thia-6-azabicyclo[2.2.0]hexane-3,5-dione |
|---|---|
| PubChem CID | 134873628 |
| Molecular Formula | C23H18N2O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-(N-methylanilino)-4,6-diphenyl-2-thia-6-azabicyclo[2.2.0]hexane-3,5-dione |
| SMILES | CN(c1ccccc1)C12SC(=O)C1(c1ccccc1)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C23H18N2O2S/c1-24(18-13-7-3-8-14-18)23-22(21(27)28-23,17-11-5-2-6-12-17)20(26)25(23)19-15-9-4-10-16-19/h2-16H,1H3 |
| InChIKey | VXODLPOVWABBOS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|