C15H13Cl3O3S — CID 134876085
2-(benzenesulfinyl)-2,2-dichloro-1-(2-chloro-5-methoxyphenyl)ethanol (PubChem CID 134876085) has the molecular formula C15H13Cl3O3S and a molecular weight of 379.69 g/mol. Its IUPAC name is 2-(benzenesulfinyl)-2,2-dichloro-1-(2-chloro-5-methoxyphenyl)ethanol.
| Compound Name | 2-(benzenesulfinyl)-2,2-dichloro-1-(2-chloro-5-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 134876085 |
| Molecular Formula | C15H13Cl3O3S |
| Molecular Weight | 379.69 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 2-(benzenesulfinyl)-2,2-dichloro-1-(2-chloro-5-methoxyphenyl)ethanol |
| SMILES | COc1ccc(Cl)c(C(O)C(Cl)(Cl)S(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C15H13Cl3O3S/c1-21-10-7-8-13(16)12(9-10)14(19)15(17,18)22(20)11-5-3-2-4-6-11/h2-9,14,19H,1H3 |
| InChIKey | HJCCREQGFKIICT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|