C17H20N4O5 — CID 134876100
methyl 5-cyano-6-(dimethylamino)-2-hydroxy-2-methyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyridine-3-carboxylate (PubChem CID 134876100) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is methyl 5-cyano-6-(dimethylamino)-2-hydroxy-2-methyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyridine-3-carboxylate.
| Compound Name | methyl 5-cyano-6-(dimethylamino)-2-hydroxy-2-methyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134876100 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | methyl 5-cyano-6-(dimethylamino)-2-hydroxy-2-methyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)C1C(c2cccc([N+](=O)[O-])c2)C(C#N)=C(N(C)C)NC1(C)O |
| InChI | InChI=1S/C17H20N4O5/c1-17(23)14(16(22)26-4)13(12(9-18)15(19-17)20(2)3)10-6-5-7-11(8-10)21(24)25/h5-8,13-14,19,23H,1-4H3 |
| InChIKey | WXNSZWBXQFNRSH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|