C23H47NO3Sn — CID 134876140
[(1S)-4-oxo-1-tributylstannylbutyl] N,N-di(propan-2-yl)carbamate (PubChem CID 134876140) has the molecular formula C23H47NO3Sn and a molecular weight of 504.34 g/mol. Its IUPAC name is [(1S)-4-oxo-1-tributylstannylbutyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(1S)-4-oxo-1-tributylstannylbutyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 134876140 |
| Molecular Formula | C23H47NO3Sn |
| Molecular Weight | 504.34 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | [(1S)-4-oxo-1-tributylstannylbutyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@@H](CCC=O)OC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C11H20NO3.3C4H9.Sn/c1-9(2)12(10(3)4)11(14)15-8-6-5-7-13;3*1-3-4-2;/h7-10H,5-6H2,1-4H3;3*1,3-4H2,2H3; |
| InChIKey | WQRFXHUKJBILDQ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.34 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|