C19H27NO5 — CID 134878184
methyl (2S)-2-acetamido-3-(4-acetyloxy-3-ethyl-2-propan-2-ylphenyl)propanoate (PubChem CID 134878184) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl (2S)-2-acetamido-3-(4-acetyloxy-3-ethyl-2-propan-2-ylphenyl)propanoate.
| Compound Name | methyl (2S)-2-acetamido-3-(4-acetyloxy-3-ethyl-2-propan-2-ylphenyl)propanoate |
|---|---|
| PubChem CID | 134878184 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | methyl (2S)-2-acetamido-3-(4-acetyloxy-3-ethyl-2-propan-2-ylphenyl)propanoate |
| SMILES | CCc1c(OC(C)=O)ccc(C[C@H](NC(C)=O)C(=O)OC)c1C(C)C |
| InChI | InChI=1S/C19H27NO5/c1-7-15-17(25-13(5)22)9-8-14(18(15)11(2)3)10-16(19(23)24-6)20-12(4)21/h8-9,11,16H,7,10H2,1-6H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | LQCDVIWPJIVOIZ-INIZCTEOSA-N |
| XLogP | 2.52 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|