C19H17F7O4S — CID 134879004
[(1S)-3,3,4,4,5,5,5-heptafluoro-1-phenylmethoxypentyl] 4-methylbenzenesulfonate (PubChem CID 134879004) has the molecular formula C19H17F7O4S and a molecular weight of 474.39 g/mol. Its IUPAC name is [(1S)-3,3,4,4,5,5,5-heptafluoro-1-phenylmethoxypentyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S)-3,3,4,4,5,5,5-heptafluoro-1-phenylmethoxypentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134879004 |
| Molecular Formula | C19H17F7O4S |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | [(1S)-3,3,4,4,5,5,5-heptafluoro-1-phenylmethoxypentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H](CC(F)(F)C(F)(F)C(F)(F)F)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H17F7O4S/c1-13-7-9-15(10-8-13)31(27,28)30-16(29-12-14-5-3-2-4-6-14)11-17(20,21)18(22,23)19(24,25)26/h2-10,16H,11-12H2,1H3/t16-/m0/s1 |
| InChIKey | VSRJRECUKOKEMZ-INIZCTEOSA-N |
| XLogP | 5.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|