About sodium 3-bromopyridin-2-olate
sodium 3-bromopyridin-2-olate (PubChem CID 134879941) has the molecular formula C5H3BrNNaO
and a molecular weight of 195.98 g/mol. Its IUPAC name is sodium 3-bromopyridin-2-olate.
Molecular Properties
| Compound Name | sodium 3-bromopyridin-2-olate |
| PubChem CID | 134879941 |
| Molecular Formula | C5H3BrNNaO |
| Molecular Weight | 195.98 g/mol |
| Exact Mass | 194.93 |
| IUPAC Name | sodium 3-bromopyridin-2-olate |
| SMILES | [Na+].[O-]c1ncccc1Br |
| InChI | InChI=1S/C5H4BrNO.Na/c6-4-2-1-3-7-5(4)8;/h1-3H,(H,7,8);/q;+1/p-1 |
| InChIKey | XNVYIYYEVDRYMT-UHFFFAOYSA-M |
| XLogP | -2.08 |
| TPSA | 35.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.98 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium 3-bromopyridin-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-bromopyridin-2-olate?
The IUPAC name of sodium 3-bromopyridin-2-olate (CID 134879941) is sodium 3-bromopyridin-2-olate.
What is the SMILES notation for sodium 3-bromopyridin-2-olate?
The canonical SMILES for sodium 3-bromopyridin-2-olate is [Na+].[O-]c1ncccc1Br.
What is the InChIKey of sodium 3-bromopyridin-2-olate?
The InChIKey is XNVYIYYEVDRYMT-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H4BrNO.Na/c6-4-2-1-3-7-5(4)8;/h1-3H,(H,7,8);/q;+1/p-1.
What are the key properties of sodium 3-bromopyridin-2-olate?
sodium 3-bromopyridin-2-olate has a molecular weight of 195.98 g/mol, XLogP of -2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-bromopyridin-2-olate is sourced from PubChem (CID 134879941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).