sodium 3-bromopyridin-2-olate

C5H3BrNNaO — CID 134879941

IUPACsodium 3-bromopyridin-2-olate
SMILES[Na+].[O-]c1ncccc1Br
InChIInChI=1S/C5H4BrNO.Na/c6-4-2-1-3-7-5(4)8;/h1-3H,(H,7,8);/q;+1/p-1
InChIKeyXNVYIYYEVDRYMT-UHFFFAOYSA-M
MW195.98 g/mol
LogP-2.08
Rot. Bonds

About sodium 3-bromopyridin-2-olate

sodium 3-bromopyridin-2-olate (PubChem CID 134879941) has the molecular formula C5H3BrNNaO and a molecular weight of 195.98 g/mol. Its IUPAC name is sodium 3-bromopyridin-2-olate.

Molecular Properties

Compound Namesodium 3-bromopyridin-2-olate
PubChem CID134879941
Molecular FormulaC5H3BrNNaO
Molecular Weight195.98 g/mol
Exact Mass194.93
IUPAC Namesodium 3-bromopyridin-2-olate
SMILES[Na+].[O-]c1ncccc1Br
InChIInChI=1S/C5H4BrNO.Na/c6-4-2-1-3-7-5(4)8;/h1-3H,(H,7,8);/q;+1/p-1
InChIKeyXNVYIYYEVDRYMT-UHFFFAOYSA-M
XLogP-2.08
TPSA35.95 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.98
LogP ≤ 5-2.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze sodium 3-bromopyridin-2-olate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 3-bromopyridin-2-olate?
The IUPAC name of sodium 3-bromopyridin-2-olate (CID 134879941) is sodium 3-bromopyridin-2-olate.
What is the SMILES notation for sodium 3-bromopyridin-2-olate?
The canonical SMILES for sodium 3-bromopyridin-2-olate is [Na+].[O-]c1ncccc1Br.
What is the InChIKey of sodium 3-bromopyridin-2-olate?
The InChIKey is XNVYIYYEVDRYMT-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H4BrNO.Na/c6-4-2-1-3-7-5(4)8;/h1-3H,(H,7,8);/q;+1/p-1.
What are the key properties of sodium 3-bromopyridin-2-olate?
sodium 3-bromopyridin-2-olate has a molecular weight of 195.98 g/mol, XLogP of -2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-bromopyridin-2-olate is sourced from PubChem (CID 134879941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).