C17H32O2Sn — CID 134880517
[(Z,2R)-2-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]pent-3-en-2-yl]oxymethyl-trimethylstannane (PubChem CID 134880517) has the molecular formula C17H32O2Sn and a molecular weight of 387.15 g/mol. Its IUPAC name is [(Z,2R)-2-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]pent-3-en-2-yl]oxymethyl-trimethylstannane.
| Compound Name | [(Z,2R)-2-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]pent-3-en-2-yl]oxymethyl-trimethylstannane |
|---|---|
| PubChem CID | 134880517 |
| Molecular Formula | C17H32O2Sn |
| Molecular Weight | 387.15 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [(Z,2R)-2-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]pent-3-en-2-yl]oxymethyl-trimethylstannane |
| SMILES | C/C=C\[C@@](C)(OC[Sn](C)(C)C)[C@H]1CC=C(C)[C@@H](CC)O1 |
| InChI | InChI=1S/C14H23O2.3CH3.Sn/c1-6-10-14(4,15-5)13-9-8-11(3)12(7-2)16-13;;;;/h6,8,10,12-13H,5,7,9H2,1-4H3;3*1H3;/b10-6-;;;;/t12-,13-,14-;;;;/m1..../s1 |
| InChIKey | YGTDQGHCLCKDPC-CHLVBOEWSA-N |
| XLogP | 4.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.15 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|