C27H38O5S — CID 134880851
[(6R,10R,13S,17S)-17-hydroxy-10,13,17-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl] 4-methylbenzenesulfonate (PubChem CID 134880851) has the molecular formula C27H38O5S and a molecular weight of 474.66 g/mol. Its IUPAC name is [(6R,10R,13S,17S)-17-hydroxy-10,13,17-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [(6R,10R,13S,17S)-17-hydroxy-10,13,17-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134880851 |
| Molecular Formula | C27H38O5S |
| Molecular Weight | 474.66 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | [(6R,10R,13S,17S)-17-hydroxy-10,13,17-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CC3C(CC[C@@]4(C)C3CC[C@]4(C)O)[C@@]3(C)CCC(=O)CC23)cc1 |
| InChI | InChI=1S/C27H38O5S/c1-17-5-7-19(8-6-17)33(30,31)32-24-16-20-21(25(2)12-9-18(28)15-23(24)25)10-13-26(3)22(20)11-14-27(26,4)29/h5-8,20-24,29H,9-16H2,1-4H3/t20?,21?,22?,23?,24-,25-,26+,27+/m1/s1 |
| InChIKey | NNAUGGMBRMYEIK-PJNZYUJQSA-N |
| XLogP | 5.04 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.66 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|