C26H39F3O4 — CID 134881144
methyl (E)-8-[(1S,4S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-4-(2,2,2-trifluoroacetyl)oxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-5-methyloct-4-enoate (PubChem CID 134881144) has the molecular formula C26H39F3O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is methyl (E)-8-[(1S,4S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-4-(2,2,2-trifluoroacetyl)oxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-5-methyloct-4-enoate.
| Compound Name | methyl (E)-8-[(1S,4S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-4-(2,2,2-trifluoroacetyl)oxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-5-methyloct-4-enoate |
|---|---|
| PubChem CID | 134881144 |
| Molecular Formula | C26H39F3O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | methyl (E)-8-[(1S,4S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-4-(2,2,2-trifluoroacetyl)oxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-5-methyloct-4-enoate |
| SMILES | C=C1C[C@H](OC(=O)C(F)(F)F)[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1CCC/C(C)=C/CCC(=O)OC |
| InChI | InChI=1S/C26H39F3O4/c1-17(11-8-13-21(30)32-6)10-7-12-19-18(2)16-20(33-23(31)26(27,28)29)22-24(3,4)14-9-15-25(19,22)5/h11,19-20,22H,2,7-10,12-16H2,1,3-6H3/b17-11+/t19-,20-,22-,25+/m0/s1 |
| InChIKey | JUXOELSEDQGWIF-INHHGJJFSA-N |
| XLogP | 6.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|