C55H70 — CID 134882298
CID 134882298 (PubChem CID 134882298) has the molecular formula C55H70 and a molecular weight of 731.16 g/mol.
| Compound Name | CID 134882298 |
|---|---|
| PubChem CID | 134882298 |
| Molecular Formula | C55H70 |
| Molecular Weight | 731.16 g/mol |
| Exact Mass | 730.55 |
| IUPAC Name | — |
| SMILES | Cc1c([C](c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)c(C(C)C)cc(C(C)C)c1[C](c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C55H70/c1-35(2)46-34-47(36(3)4)49(51(40-22-30-44(31-23-40)54(12,13)14)41-24-32-45(33-25-41)55(15,16)17)37(5)48(46)50(38-18-26-42(27-19-38)52(6,7)8)39-20-28-43(29-21-39)53(9,10)11/h18-36H,1-17H3 |
| InChIKey | MRAXKBJGEIQJER-UHFFFAOYSA-N |
| XLogP | 15.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.16 |
| LogP ≤ 5 | 15.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|