C23H22NOSe+ — CID 134883776
(2Z,3S,4S)-2-[(4-methylphenyl)methylidene]-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium (PubChem CID 134883776) has the molecular formula C23H22NOSe+ and a molecular weight of 407.40 g/mol. Its IUPAC name is (2Z,3S,4S)-2-[(4-methylphenyl)methylidene]-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium.
| Compound Name | (2Z,3S,4S)-2-[(4-methylphenyl)methylidene]-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium |
|---|---|
| PubChem CID | 134883776 |
| Molecular Formula | C23H22NOSe+ |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (2Z,3S,4S)-2-[(4-methylphenyl)methylidene]-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium |
| SMILES | Cc1ccc(/C=[N+]2\OC[C@@H]([Se]c3ccccc3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22NOSe/c1-18-12-14-19(15-13-18)16-24-23(20-8-4-2-5-9-20)22(17-25-24)26-21-10-6-3-7-11-21/h2-16,22-23H,17H2,1H3/q+1/b24-16-/t22-,23+/m1/s1 |
| InChIKey | UBRFOARYNYWAAI-LDSWFEIXSA-N |
| XLogP | 3.93 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|