C26H27NOSe — CID 134985451
(3S,4S)-2-[1-(4-methylphenyl)but-3-enyl]-3-phenyl-4-phenylselanyl-1,2-oxazolidine (PubChem CID 134985451) has the molecular formula C26H27NOSe and a molecular weight of 448.47 g/mol. Its IUPAC name is (3S,4S)-2-[1-(4-methylphenyl)but-3-enyl]-3-phenyl-4-phenylselanyl-1,2-oxazolidine.
| Compound Name | (3S,4S)-2-[1-(4-methylphenyl)but-3-enyl]-3-phenyl-4-phenylselanyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 134985451 |
| Molecular Formula | C26H27NOSe |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | (3S,4S)-2-[1-(4-methylphenyl)but-3-enyl]-3-phenyl-4-phenylselanyl-1,2-oxazolidine |
| SMILES | C=CCC(c1ccc(C)cc1)N1OC[C@@H]([Se]c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H27NOSe/c1-3-10-24(21-17-15-20(2)16-18-21)27-26(22-11-6-4-7-12-22)25(19-28-27)29-23-13-8-5-9-14-23/h3-9,11-18,24-26H,1,10,19H2,2H3/t24?,25-,26+/m1/s1 |
| InChIKey | FQHHJDDQBXWQFF-KBEVGPIXSA-N |
| XLogP | 5.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|