C23H23NOSe — CID 134984307
(3S,4S)-3-phenyl-2-(1-phenylethyl)-4-phenylselanyl-1,2-oxazolidine (PubChem CID 134984307) has the molecular formula C23H23NOSe and a molecular weight of 408.40 g/mol. Its IUPAC name is (3S,4S)-3-phenyl-2-(1-phenylethyl)-4-phenylselanyl-1,2-oxazolidine.
| Compound Name | (3S,4S)-3-phenyl-2-(1-phenylethyl)-4-phenylselanyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 134984307 |
| Molecular Formula | C23H23NOSe |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | (3S,4S)-3-phenyl-2-(1-phenylethyl)-4-phenylselanyl-1,2-oxazolidine |
| SMILES | CC(c1ccccc1)N1OC[C@@H]([Se]c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H23NOSe/c1-18(19-11-5-2-6-12-19)24-23(20-13-7-3-8-14-20)22(17-25-24)26-21-15-9-4-10-16-21/h2-16,18,22-23H,17H2,1H3/t18?,22-,23+/m1/s1 |
| InChIKey | JMNWJBBIJROMQV-ZPUYXXQXSA-N |
| XLogP | 4.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|