C22H19BrClNOSe — CID 134883777
(2Z,3S,4S)-2-[(4-chlorophenyl)methylidene]-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium bromide (PubChem CID 134883777) has the molecular formula C22H19BrClNOSe and a molecular weight of 507.72 g/mol. Its IUPAC name is (2Z,3S,4S)-2-[(4-chlorophenyl)methylidene]-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium bromide.
| Compound Name | (2Z,3S,4S)-2-[(4-chlorophenyl)methylidene]-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium bromide |
|---|---|
| PubChem CID | 134883777 |
| Molecular Formula | C22H19BrClNOSe |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 506.95 |
| IUPAC Name | (2Z,3S,4S)-2-[(4-chlorophenyl)methylidene]-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium bromide |
| SMILES | Clc1ccc(/C=[N+]2\OC[C@@H]([Se]c3ccccc3)[C@@H]2c2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C22H19ClNOSe.BrH/c23-19-13-11-17(12-14-19)15-24-22(18-7-3-1-4-8-18)21(16-25-24)26-20-9-5-2-6-10-20;/h1-15,21-22H,16H2;1H/q+1;/p-1/b24-15-;/t21-,22+;/m1./s1 |
| InChIKey | AMVMIJZYJKFICT-YTGQSSEASA-M |
| XLogP | 1.28 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|