C22H19ClNOSe+ — CID 134883778
(2Z,3S,4S)-2-[(4-chlorophenyl)methylidene]-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium (PubChem CID 134883778) has the molecular formula C22H19ClNOSe+ and a molecular weight of 427.81 g/mol. Its IUPAC name is (2Z,3S,4S)-2-[(4-chlorophenyl)methylidene]-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium.
| Compound Name | (2Z,3S,4S)-2-[(4-chlorophenyl)methylidene]-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium |
|---|---|
| PubChem CID | 134883778 |
| Molecular Formula | C22H19ClNOSe+ |
| Molecular Weight | 427.81 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | (2Z,3S,4S)-2-[(4-chlorophenyl)methylidene]-3-phenyl-4-phenylselanyl-1,2-oxazolidin-2-ium |
| SMILES | Clc1ccc(/C=[N+]2\OC[C@@H]([Se]c3ccccc3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19ClNOSe/c23-19-13-11-17(12-14-19)15-24-22(18-7-3-1-4-8-18)21(16-25-24)26-20-9-5-2-6-10-20/h1-15,21-22H,16H2/q+1/b24-15-/t21-,22+/m1/s1 |
| InChIKey | CQKFGMSHMXVDNZ-VHBXHHEJSA-N |
| XLogP | 4.28 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.81 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|