C23H22ClNOSe — CID 11751110
(3S,4S)-2-[1-(4-chlorophenyl)ethyl]-3-phenyl-4-phenylselanyl-1,2-oxazolidine (PubChem CID 11751110) has the molecular formula C23H22ClNOSe and a molecular weight of 442.85 g/mol. Its IUPAC name is (3S,4S)-2-[1-(4-chlorophenyl)ethyl]-3-phenyl-4-phenylselanyl-1,2-oxazolidine.
| Compound Name | (3S,4S)-2-[1-(4-chlorophenyl)ethyl]-3-phenyl-4-phenylselanyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 11751110 |
| Molecular Formula | C23H22ClNOSe |
| Molecular Weight | 442.85 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | (3S,4S)-2-[1-(4-chlorophenyl)ethyl]-3-phenyl-4-phenylselanyl-1,2-oxazolidine |
| SMILES | CC(c1ccc(Cl)cc1)N1OC[C@@H]([Se]c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H22ClNOSe/c1-17(18-12-14-20(24)15-13-18)25-23(19-8-4-2-5-9-19)22(16-26-25)27-21-10-6-3-7-11-21/h2-15,17,22-23H,16H2,1H3/t17?,22-,23+/m1/s1 |
| InChIKey | ADYYYALYAZRVIU-FCRIIEAOSA-N |
| XLogP | 5.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.85 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|