C28H25NOSe — CID 134984687
(3S,4S)-2-benzhydryl-3-phenyl-4-phenylselanyl-1,2-oxazolidine (PubChem CID 134984687) has the molecular formula C28H25NOSe and a molecular weight of 470.47 g/mol. Its IUPAC name is (3S,4S)-2-benzhydryl-3-phenyl-4-phenylselanyl-1,2-oxazolidine.
| Compound Name | (3S,4S)-2-benzhydryl-3-phenyl-4-phenylselanyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 134984687 |
| Molecular Formula | C28H25NOSe |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | (3S,4S)-2-benzhydryl-3-phenyl-4-phenylselanyl-1,2-oxazolidine |
| SMILES | c1ccc([Se][C@@H]2CON(C(c3ccccc3)c3ccccc3)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25NOSe/c1-5-13-22(14-6-1)27(23-15-7-2-8-16-23)29-28(24-17-9-3-10-18-24)26(21-30-29)31-25-19-11-4-12-20-25/h1-20,26-28H,21H2/t26-,28+/m1/s1 |
| InChIKey | WBQJZYRYORMFPD-IAPPQJPRSA-N |
| XLogP | 5.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|