C21H27NOSe — CID 134983817
(3S,4S)-2-(3-methylpentan-3-yl)-3-phenyl-4-phenylselanyl-1,2-oxazolidine (PubChem CID 134983817) has the molecular formula C21H27NOSe and a molecular weight of 388.41 g/mol. Its IUPAC name is (3S,4S)-2-(3-methylpentan-3-yl)-3-phenyl-4-phenylselanyl-1,2-oxazolidine.
| Compound Name | (3S,4S)-2-(3-methylpentan-3-yl)-3-phenyl-4-phenylselanyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 134983817 |
| Molecular Formula | C21H27NOSe |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (3S,4S)-2-(3-methylpentan-3-yl)-3-phenyl-4-phenylselanyl-1,2-oxazolidine |
| SMILES | CCC(C)(CC)N1OC[C@@H]([Se]c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H27NOSe/c1-4-21(3,5-2)22-20(17-12-8-6-9-13-17)19(16-23-22)24-18-14-10-7-11-15-18/h6-15,19-20H,4-5,16H2,1-3H3/t19-,20+/m1/s1 |
| InChIKey | CBZLKMVJGLUBCD-UXHICEINSA-N |
| XLogP | 4.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|