C29H52BO4- — CID 134884249
methoxy-[(Z)-3-(2-methoxyethoxymethoxy)but-2-enyl]-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]boranuide (PubChem CID 134884249) has the molecular formula C29H52BO4- and a molecular weight of 475.54 g/mol. Its IUPAC name is methoxy-[(Z)-3-(2-methoxyethoxymethoxy)but-2-enyl]-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]boranuide.
| Compound Name | methoxy-[(Z)-3-(2-methoxyethoxymethoxy)but-2-enyl]-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]boranuide |
|---|---|
| PubChem CID | 134884249 |
| Molecular Formula | C29H52BO4- |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.40 |
| IUPAC Name | methoxy-[(Z)-3-(2-methoxyethoxymethoxy)but-2-enyl]-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]boranuide |
| SMILES | COCCOCO/C(C)=C\C[B-](OC)([C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C)[C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C |
| InChI | InChI=1S/C29H52BO4/c1-19(34-18-33-13-12-31-8)10-11-30(32-9,26-16-22-14-24(20(26)2)28(22,4)5)27-17-23-15-25(21(27)3)29(23,6)7/h10,20-27H,11-18H2,1-9H3/q-1/b19-10-/t20-,21-,22+,23+,24-,25-,26-,27-/m1/s1 |
| InChIKey | ILTFHTHEPTWOTD-VDSVAYTGSA-N |
| XLogP | 7.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|