C27H47BO3 — CID 102353405
[(E)-3-(2-methoxyethoxymethoxy)prop-2-enyl]-bis[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane (PubChem CID 102353405) has the molecular formula C27H47BO3 and a molecular weight of 430.48 g/mol. Its IUPAC name is [(E)-3-(2-methoxyethoxymethoxy)prop-2-enyl]-bis[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane.
| Compound Name | [(E)-3-(2-methoxyethoxymethoxy)prop-2-enyl]-bis[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
|---|---|
| PubChem CID | 102353405 |
| Molecular Formula | C27H47BO3 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.36 |
| IUPAC Name | [(E)-3-(2-methoxyethoxymethoxy)prop-2-enyl]-bis[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
| SMILES | COCCOCO/C=C/CB([C@H]1C[C@H]2C[C@@H]([C@@H]1C)C2(C)C)[C@H]1C[C@H]2C[C@@H]([C@@H]1C)C2(C)C |
| InChI | InChI=1S/C27H47BO3/c1-18-22-13-20(26(22,3)4)15-24(18)28(9-8-10-30-17-31-12-11-29-7)25-16-21-14-23(19(25)2)27(21,5)6/h8,10,18-25H,9,11-17H2,1-7H3/b10-8+/t18-,19-,20+,21+,22-,23-,24-,25-/m0/s1 |
| InChIKey | WJQBQIWLGRPMNG-VTJSJSAXSA-N |
| XLogP | 6.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|