C25H43BO2 — CID 177415942
3-(methoxymethoxy)prop-2-enyl-bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]borane (PubChem CID 177415942) has the molecular formula C25H43BO2 and a molecular weight of 386.43 g/mol. Its IUPAC name is 3-(methoxymethoxy)prop-2-enyl-bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]borane.
| Compound Name | 3-(methoxymethoxy)prop-2-enyl-bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]borane |
|---|---|
| PubChem CID | 177415942 |
| Molecular Formula | C25H43BO2 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.34 |
| IUPAC Name | 3-(methoxymethoxy)prop-2-enyl-bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]borane |
| SMILES | COCOC=CCB([C@@H]1C[C@@H]2CC[C@]1(C)C2(C)C)[C@@H]1C[C@@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C25H43BO2/c1-22(2)18-9-11-24(22,5)20(15-18)26(13-8-14-28-17-27-7)21-16-19-10-12-25(21,6)23(19,3)4/h8,14,18-21H,9-13,15-17H2,1-7H3/t18-,19-,20+,21+,24-,25-/m0/s1 |
| InChIKey | LYCPTWHECRXHPZ-IPGAFUANSA-N |
| XLogP | 7.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|