About 5-nitropentan-1-amine;hydrochloride
5-nitropentan-1-amine;hydrochloride (PubChem CID 134884267) has the molecular formula C5H13ClN2O2
and a molecular weight of 168.62 g/mol. Its IUPAC name is 5-nitropentan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-nitropentan-1-amine;hydrochloride |
| PubChem CID | 134884267 |
| Molecular Formula | C5H13ClN2O2 |
| Molecular Weight | 168.62 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 5-nitropentan-1-amine;hydrochloride |
| SMILES | Cl.NCCCCC[N+](=O)[O-] |
| InChI | InChI=1S/C5H12N2O2.ClH/c6-4-2-1-3-5-7(8)9;/h1-6H2;1H |
| InChIKey | GESWCEJOYVCNDY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.62 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitropentan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitropentan-1-amine;hydrochloride?
The IUPAC name of 5-nitropentan-1-amine;hydrochloride (CID 134884267) is 5-nitropentan-1-amine;hydrochloride.
What is the SMILES notation for 5-nitropentan-1-amine;hydrochloride?
The canonical SMILES for 5-nitropentan-1-amine;hydrochloride is Cl.NCCCCC[N+](=O)[O-].
What is the InChIKey of 5-nitropentan-1-amine;hydrochloride?
The InChIKey is GESWCEJOYVCNDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2.ClH/c6-4-2-1-3-5-7(8)9;/h1-6H2;1H.
What are the key properties of 5-nitropentan-1-amine;hydrochloride?
5-nitropentan-1-amine;hydrochloride has a molecular weight of 168.62 g/mol, XLogP of 0.81, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitropentan-1-amine;hydrochloride is sourced from PubChem (CID 134884267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).