About 4-nitrobutan-1-amine
4-nitrobutan-1-amine (PubChem CID 18931601) has the molecular formula C4H10N2O2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 4-nitrobutan-1-amine.
Molecular Properties
| Compound Name | 4-nitrobutan-1-amine |
| PubChem CID | 18931601 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | 4-nitrobutan-1-amine |
| SMILES | NCCCC[N+](=O)[O-] |
| InChI | InChI=1S/C4H10N2O2/c5-3-1-2-4-6(7)8/h1-5H2 |
| InChIKey | FWCJKIJOSHJPKR-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrobutan-1-amine?
The IUPAC name of 4-nitrobutan-1-amine (CID 18931601) is 4-nitrobutan-1-amine.
What is the SMILES notation for 4-nitrobutan-1-amine?
The canonical SMILES for 4-nitrobutan-1-amine is NCCCC[N+](=O)[O-].
What is the InChIKey of 4-nitrobutan-1-amine?
The InChIKey is FWCJKIJOSHJPKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2/c5-3-1-2-4-6(7)8/h1-5H2.
What are the key properties of 4-nitrobutan-1-amine?
4-nitrobutan-1-amine has a molecular weight of 118.14 g/mol, XLogP of 0.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrobutan-1-amine is sourced from PubChem (CID 18931601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).