About 4,4-dinitrobutan-1-amine
4,4-dinitrobutan-1-amine (PubChem CID 151719818) has the molecular formula C4H9N3O4
and a molecular weight of 163.13 g/mol. Its IUPAC name is 4,4-dinitrobutan-1-amine.
Molecular Properties
| Compound Name | 4,4-dinitrobutan-1-amine |
| PubChem CID | 151719818 |
| Molecular Formula | C4H9N3O4 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 4,4-dinitrobutan-1-amine |
| SMILES | NCCCC([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C4H9N3O4/c5-3-1-2-4(6(8)9)7(10)11/h4H,1-3,5H2 |
| InChIKey | RIILIWCQZBSEIQ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dinitrobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dinitrobutan-1-amine?
The IUPAC name of 4,4-dinitrobutan-1-amine (CID 151719818) is 4,4-dinitrobutan-1-amine.
What is the SMILES notation for 4,4-dinitrobutan-1-amine?
The canonical SMILES for 4,4-dinitrobutan-1-amine is NCCCC([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 4,4-dinitrobutan-1-amine?
The InChIKey is RIILIWCQZBSEIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3O4/c5-3-1-2-4(6(8)9)7(10)11/h4H,1-3,5H2.
What are the key properties of 4,4-dinitrobutan-1-amine?
4,4-dinitrobutan-1-amine has a molecular weight of 163.13 g/mol, XLogP of -0.40, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dinitrobutan-1-amine is sourced from PubChem (CID 151719818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).