C15H18INO3 — CID 134885466
(3aR,4R,6R,6aS)-6-(3-iodopropyl)-4-methoxy-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole (PubChem CID 134885466) has the molecular formula C15H18INO3 and a molecular weight of 387.22 g/mol. Its IUPAC name is (3aR,4R,6R,6aS)-6-(3-iodopropyl)-4-methoxy-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole.
| Compound Name | (3aR,4R,6R,6aS)-6-(3-iodopropyl)-4-methoxy-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole |
|---|---|
| PubChem CID | 134885466 |
| Molecular Formula | C15H18INO3 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | (3aR,4R,6R,6aS)-6-(3-iodopropyl)-4-methoxy-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole |
| SMILES | CO[C@@H]1O[C@H](CCCI)[C@H]2OC(c3ccccc3)=N[C@@H]12 |
| InChI | InChI=1S/C15H18INO3/c1-18-15-12-13(11(19-15)8-5-9-16)20-14(17-12)10-6-3-2-4-7-10/h2-4,6-7,11-13,15H,5,8-9H2,1H3/t11-,12-,13-,15-/m1/s1 |
| InChIKey | PSFBOYPXTRAVDL-RGCMKSIDSA-N |
| XLogP | 2.79 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|