C24H26F3NO5 — CID 144664794
2-[2-[(3aR,6S,6aR)-6-phenylmethoxy-2-[4-(trifluoromethyl)phenyl]-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazol-5-yl]ethoxy]propan-2-ol (PubChem CID 144664794) has the molecular formula C24H26F3NO5 and a molecular weight of 465.47 g/mol. Its IUPAC name is 2-[2-[(3aR,6S,6aR)-6-phenylmethoxy-2-[4-(trifluoromethyl)phenyl]-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazol-5-yl]ethoxy]propan-2-ol.
| Compound Name | 2-[2-[(3aR,6S,6aR)-6-phenylmethoxy-2-[4-(trifluoromethyl)phenyl]-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazol-5-yl]ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 144664794 |
| Molecular Formula | C24H26F3NO5 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 2-[2-[(3aR,6S,6aR)-6-phenylmethoxy-2-[4-(trifluoromethyl)phenyl]-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazol-5-yl]ethoxy]propan-2-ol |
| SMILES | CC(C)(O)OCCC1O[C@@H]2OC(c3ccc(C(F)(F)F)cc3)=N[C@@H]2[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C24H26F3NO5/c1-23(2,29)31-13-12-18-20(30-14-15-6-4-3-5-7-15)19-22(32-18)33-21(28-19)16-8-10-17(11-9-16)24(25,26)27/h3-11,18-20,22,29H,12-14H2,1-2H3/t18?,19-,20-,22-/m1/s1 |
| InChIKey | WBKADWQAYSBRIZ-SRNQMFCMSA-N |
| XLogP | 4.30 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|