C42H42O8S2 — CID 134886059
3-[1-methoxy-8-[8-methoxy-7-[3-(4-methylphenyl)sulfonyloxypropyl]naphthalen-1-yl]naphthalen-2-yl]propyl 4-methylbenzenesulfonate (PubChem CID 134886059) has the molecular formula C42H42O8S2 and a molecular weight of 738.92 g/mol. Its IUPAC name is 3-[1-methoxy-8-[8-methoxy-7-[3-(4-methylphenyl)sulfonyloxypropyl]naphthalen-1-yl]naphthalen-2-yl]propyl 4-methylbenzenesulfonate.
| Compound Name | 3-[1-methoxy-8-[8-methoxy-7-[3-(4-methylphenyl)sulfonyloxypropyl]naphthalen-1-yl]naphthalen-2-yl]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134886059 |
| Molecular Formula | C42H42O8S2 |
| Molecular Weight | 738.92 g/mol |
| Exact Mass | 738.23 |
| IUPAC Name | 3-[1-methoxy-8-[8-methoxy-7-[3-(4-methylphenyl)sulfonyloxypropyl]naphthalen-1-yl]naphthalen-2-yl]propyl 4-methylbenzenesulfonate |
| SMILES | COc1c(CCCOS(=O)(=O)c2ccc(C)cc2)ccc2cccc(-c3cccc4ccc(CCCOS(=O)(=O)c5ccc(C)cc5)c(OC)c34)c12 |
| InChI | InChI=1S/C42H42O8S2/c1-29-15-23-35(24-16-29)51(43,44)49-27-7-11-33-21-19-31-9-5-13-37(39(31)41(33)47-3)38-14-6-10-32-20-22-34(42(48-4)40(32)38)12-8-28-50-52(45,46)36-25-17-30(2)18-26-36/h5-6,9-10,13-26H,7-8,11-12,27-28H2,1-4H3 |
| InChIKey | ADJJNVJVNMMENP-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.92 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|