C15H32NO2P — CID 134886088
methyl (2R)-2-[[butan-2-yl(tert-butyl)phosphanyl]amino]-4-methylpentanoate (PubChem CID 134886088) has the molecular formula C15H32NO2P and a molecular weight of 289.40 g/mol. Its IUPAC name is methyl (2R)-2-[[butan-2-yl(tert-butyl)phosphanyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[[butan-2-yl(tert-butyl)phosphanyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 134886088 |
| Molecular Formula | C15H32NO2P |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | methyl (2R)-2-[[butan-2-yl(tert-butyl)phosphanyl]amino]-4-methylpentanoate |
| SMILES | CCC(C)P(N[C@H](CC(C)C)C(=O)OC)C(C)(C)C |
| InChI | InChI=1S/C15H32NO2P/c1-9-12(4)19(15(5,6)7)16-13(10-11(2)3)14(17)18-8/h11-13,16H,9-10H2,1-8H3/t12?,13-,19?/m1/s1 |
| InChIKey | VKKYWZDSVQNFSP-FWHMADFJSA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|