C15H42N4Si3 — CID 134886101
1-[2,2-bis(2-trimethylsilylethylamino)hydrazinyl]-2-trimethylsilylethane (PubChem CID 134886101) has the molecular formula C15H42N4Si3 and a molecular weight of 362.79 g/mol. Its IUPAC name is 1-[2,2-bis(2-trimethylsilylethylamino)hydrazinyl]-2-trimethylsilylethane.
| Compound Name | 1-[2,2-bis(2-trimethylsilylethylamino)hydrazinyl]-2-trimethylsilylethane |
|---|---|
| PubChem CID | 134886101 |
| Molecular Formula | C15H42N4Si3 |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 1-[2,2-bis(2-trimethylsilylethylamino)hydrazinyl]-2-trimethylsilylethane |
| SMILES | C[Si](C)(C)CCNN(NCC[Si](C)(C)C)NCC[Si](C)(C)C |
| InChI | InChI=1S/C15H42N4Si3/c1-20(2,3)13-10-16-19(17-11-14-21(4,5)6)18-12-15-22(7,8)9/h16-18H,10-15H2,1-9H3 |
| InChIKey | JAUVWGJKUGGSMF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|