C25H38NPS — CID 134886130
N-phenyl-1-tricyclohexylphosphaniumylmethanimidothioate (PubChem CID 134886130) has the molecular formula C25H38NPS and a molecular weight of 415.63 g/mol. Its IUPAC name is N-phenyl-1-tricyclohexylphosphaniumylmethanimidothioate.
| Compound Name | N-phenyl-1-tricyclohexylphosphaniumylmethanimidothioate |
|---|---|
| PubChem CID | 134886130 |
| Molecular Formula | C25H38NPS |
| Molecular Weight | 415.63 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | N-phenyl-1-tricyclohexylphosphaniumylmethanimidothioate |
| SMILES | [S-]/C(=N\c1ccccc1)[P+](C1CCCCC1)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C25H38NPS/c28-25(26-21-13-5-1-6-14-21)27(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1,5-6,13-14,22-24H,2-4,7-12,15-20H2 |
| InChIKey | IJVBQEMBIDVYBE-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.63 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|