C24H42O4 — CID 134886714
2-[(3E,7E)-10-[(1R,3S)-3-(dimethoxymethyl)-2,2-dimethylcyclopropyl]-4,8-dimethyldeca-3,7-dienyl]-2-methyl-1,3-dioxolane (PubChem CID 134886714) has the molecular formula C24H42O4 and a molecular weight of 394.60 g/mol. Its IUPAC name is 2-[(3E,7E)-10-[(1R,3S)-3-(dimethoxymethyl)-2,2-dimethylcyclopropyl]-4,8-dimethyldeca-3,7-dienyl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-[(3E,7E)-10-[(1R,3S)-3-(dimethoxymethyl)-2,2-dimethylcyclopropyl]-4,8-dimethyldeca-3,7-dienyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 134886714 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | 2-[(3E,7E)-10-[(1R,3S)-3-(dimethoxymethyl)-2,2-dimethylcyclopropyl]-4,8-dimethyldeca-3,7-dienyl]-2-methyl-1,3-dioxolane |
| SMILES | COC(OC)[C@H]1[C@@H](CC/C(C)=C/CC/C(C)=C/CCC2(C)OCCO2)C1(C)C |
| InChI | InChI=1S/C24H42O4/c1-18(12-9-15-24(5)27-16-17-28-24)10-8-11-19(2)13-14-20-21(23(20,3)4)22(25-6)26-7/h11-12,20-22H,8-10,13-17H2,1-7H3/b18-12+,19-11+/t20-,21-/m1/s1 |
| InChIKey | DOKYKBCZRFHHQZ-RERNOLRISA-N |
| XLogP | 5.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|